C11H13N3O5S — CID 62034595
2-(3-oxo-1-pyridin-3-ylsulfonylpiperazin-2-yl)acetic acid (PubChem CID 62034595) has the molecular formula C11H13N3O5S and a molecular weight of 299.31 g/mol. Its IUPAC name is 2-(3-oxo-1-pyridin-3-ylsulfonylpiperazin-2-yl)acetic acid.
| Compound Name | 2-(3-oxo-1-pyridin-3-ylsulfonylpiperazin-2-yl)acetic acid |
|---|---|
| PubChem CID | 62034595 |
| Molecular Formula | C11H13N3O5S |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 2-(3-oxo-1-pyridin-3-ylsulfonylpiperazin-2-yl)acetic acid |
| SMILES | O=C(O)CC1C(=O)NCCN1S(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C11H13N3O5S/c15-10(16)6-9-11(17)13-4-5-14(9)20(18,19)8-2-1-3-12-7-8/h1-3,7,9H,4-6H2,(H,13,17)(H,15,16) |
| InChIKey | KCLHMEVQZQAACM-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |