C18H18ClN3O4S — CID 42655918
2-[1-(benzenesulfonyl)-3-oxopiperazin-2-yl]-N-(3-chlorophenyl)acetamide (PubChem CID 42655918) has the molecular formula C18H18ClN3O4S and a molecular weight of 407.88 g/mol. Its IUPAC name is 2-[1-(benzenesulfonyl)-3-oxopiperazin-2-yl]-N-(3-chlorophenyl)acetamide.
| Compound Name | 2-[1-(benzenesulfonyl)-3-oxopiperazin-2-yl]-N-(3-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 42655918 |
| Molecular Formula | C18H18ClN3O4S |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 2-[1-(benzenesulfonyl)-3-oxopiperazin-2-yl]-N-(3-chlorophenyl)acetamide |
| SMILES | O=C(CC1C(=O)NCCN1S(=O)(=O)c1ccccc1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H18ClN3O4S/c19-13-5-4-6-14(11-13)21-17(23)12-16-18(24)20-9-10-22(16)27(25,26)15-7-2-1-3-8-15/h1-8,11,16H,9-10,12H2,(H,20,24)(H,21,23) |
| InChIKey | FCVPXUPWZKQVJX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |