C18H20N4O4S — CID 51720530
2-[(2R)-1-(benzenesulfonyl)-3-oxopiperazin-2-yl]-N-(pyridin-2-ylmethyl)acetamide (PubChem CID 51720530) has the molecular formula C18H20N4O4S and a molecular weight of 388.45 g/mol. Its IUPAC name is 2-[(2R)-1-(benzenesulfonyl)-3-oxopiperazin-2-yl]-N-(pyridin-2-ylmethyl)acetamide.
| Compound Name | 2-[(2R)-1-(benzenesulfonyl)-3-oxopiperazin-2-yl]-N-(pyridin-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 51720530 |
| Molecular Formula | C18H20N4O4S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 2-[(2R)-1-(benzenesulfonyl)-3-oxopiperazin-2-yl]-N-(pyridin-2-ylmethyl)acetamide |
| SMILES | O=C(C[C@@H]1C(=O)NCCN1S(=O)(=O)c1ccccc1)NCc1ccccn1 |
| InChI | InChI=1S/C18H20N4O4S/c23-17(21-13-14-6-4-5-9-19-14)12-16-18(24)20-10-11-22(16)27(25,26)15-7-2-1-3-8-15/h1-9,16H,10-13H2,(H,20,24)(H,21,23)/t16-/m1/s1 |
| InChIKey | SMLJZSZQVXZZQQ-MRXNPFEDSA-N |
| XLogP | 0.28 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |