C16H23N3O6S — CID 51718191
2-[(2R)-1-(benzenesulfonyl)-3-oxopiperazin-2-yl]-N-(2,2-dimethoxyethyl)acetamide (PubChem CID 51718191) has the molecular formula C16H23N3O6S and a molecular weight of 385.44 g/mol. Its IUPAC name is 2-[(2R)-1-(benzenesulfonyl)-3-oxopiperazin-2-yl]-N-(2,2-dimethoxyethyl)acetamide.
| Compound Name | 2-[(2R)-1-(benzenesulfonyl)-3-oxopiperazin-2-yl]-N-(2,2-dimethoxyethyl)acetamide |
|---|---|
| PubChem CID | 51718191 |
| Molecular Formula | C16H23N3O6S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 2-[(2R)-1-(benzenesulfonyl)-3-oxopiperazin-2-yl]-N-(2,2-dimethoxyethyl)acetamide |
| SMILES | COC(CNC(=O)C[C@@H]1C(=O)NCCN1S(=O)(=O)c1ccccc1)OC |
| InChI | InChI=1S/C16H23N3O6S/c1-24-15(25-2)11-18-14(20)10-13-16(21)17-8-9-19(13)26(22,23)12-6-4-3-5-7-12/h3-7,13,15H,8-11H2,1-2H3,(H,17,21)(H,18,20)/t13-/m1/s1 |
| InChIKey | IKKDBNXHRJEKAF-CYBMUJFWSA-N |
| XLogP | -0.70 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|