C19H29N3O5S — CID 51717166
2-[(2S)-1-(4-tert-butylphenyl)sulfonyl-3-oxopiperazin-2-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 51717166) has the molecular formula C19H29N3O5S and a molecular weight of 411.52 g/mol. Its IUPAC name is 2-[(2S)-1-(4-tert-butylphenyl)sulfonyl-3-oxopiperazin-2-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(2S)-1-(4-tert-butylphenyl)sulfonyl-3-oxopiperazin-2-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 51717166 |
| Molecular Formula | C19H29N3O5S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 2-[(2S)-1-(4-tert-butylphenyl)sulfonyl-3-oxopiperazin-2-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)C[C@H]1C(=O)NCCN1S(=O)(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H29N3O5S/c1-19(2,3)14-5-7-15(8-6-14)28(25,26)22-11-9-21-18(24)16(22)13-17(23)20-10-12-27-4/h5-8,16H,9-13H2,1-4H3,(H,20,23)(H,21,24)/t16-/m0/s1 |
| InChIKey | GSYPXTZATYCYTH-INIZCTEOSA-N |
| XLogP | 0.63 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|