C13H14F3N3O4S — CID 141109534
2-[3-oxo-1-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-2-yl]acetamide (PubChem CID 141109534) has the molecular formula C13H14F3N3O4S and a molecular weight of 365.33 g/mol. Its IUPAC name is 2-[3-oxo-1-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-2-yl]acetamide.
| Compound Name | 2-[3-oxo-1-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-2-yl]acetamide |
|---|---|
| PubChem CID | 141109534 |
| Molecular Formula | C13H14F3N3O4S |
| Molecular Weight | 365.33 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 2-[3-oxo-1-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-2-yl]acetamide |
| SMILES | NC(=O)CC1C(=O)NCCN1S(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H14F3N3O4S/c14-13(15,16)8-1-3-9(4-2-8)24(22,23)19-6-5-18-12(21)10(19)7-11(17)20/h1-4,10H,5-7H2,(H2,17,20)(H,18,21) |
| InChIKey | NRJZDBZHWNSUSU-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.33 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |