C12H14ClN3O4S — CID 143068313
2-[1-(4-chlorophenyl)sulfonyl-3-oxopiperazin-2-yl]acetamide (PubChem CID 143068313) has the molecular formula C12H14ClN3O4S and a molecular weight of 331.78 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)sulfonyl-3-oxopiperazin-2-yl]acetamide.
| Compound Name | 2-[1-(4-chlorophenyl)sulfonyl-3-oxopiperazin-2-yl]acetamide |
|---|---|
| PubChem CID | 143068313 |
| Molecular Formula | C12H14ClN3O4S |
| Molecular Weight | 331.78 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 2-[1-(4-chlorophenyl)sulfonyl-3-oxopiperazin-2-yl]acetamide |
| SMILES | NC(=O)CC1C(=O)NCCN1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H14ClN3O4S/c13-8-1-3-9(4-2-8)21(19,20)16-6-5-15-12(18)10(16)7-11(14)17/h1-4,10H,5-7H2,(H2,14,17)(H,15,18) |
| InChIKey | FWAXEESNRWNICK-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.78 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |