C13H13ClN2O3S — CID 86604871
(3R)-4-(4-chlorophenyl)sulfonyl-3-prop-2-ynylpiperazin-2-one (PubChem CID 86604871) has the molecular formula C13H13ClN2O3S and a molecular weight of 312.78 g/mol. Its IUPAC name is (3R)-4-(4-chlorophenyl)sulfonyl-3-prop-2-ynylpiperazin-2-one.
| Compound Name | (3R)-4-(4-chlorophenyl)sulfonyl-3-prop-2-ynylpiperazin-2-one |
|---|---|
| PubChem CID | 86604871 |
| Molecular Formula | C13H13ClN2O3S |
| Molecular Weight | 312.78 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | (3R)-4-(4-chlorophenyl)sulfonyl-3-prop-2-ynylpiperazin-2-one |
| SMILES | C#CC[C@@H]1C(=O)NCCN1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H13ClN2O3S/c1-2-3-12-13(17)15-8-9-16(12)20(18,19)11-6-4-10(14)5-7-11/h1,4-7,12H,3,8-9H2,(H,15,17)/t12-/m1/s1 |
| InChIKey | KGHIJLWEXMITDC-GFCCVEGCSA-N |
| XLogP | 0.85 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.78 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|