C28H41ClN4O4S — CID 175247449
2-[1-(4-chlorophenyl)sulfonyl-3-oxopiperazin-2-yl]-N-[6-(piperidin-1-ylmethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]acetamide (PubChem CID 175247449) has the molecular formula C28H41ClN4O4S and a molecular weight of 565.18 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)sulfonyl-3-oxopiperazin-2-yl]-N-[6-(piperidin-1-ylmethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]acetamide.
| Compound Name | 2-[1-(4-chlorophenyl)sulfonyl-3-oxopiperazin-2-yl]-N-[6-(piperidin-1-ylmethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]acetamide |
|---|---|
| PubChem CID | 175247449 |
| Molecular Formula | C28H41ClN4O4S |
| Molecular Weight | 565.18 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | 2-[1-(4-chlorophenyl)sulfonyl-3-oxopiperazin-2-yl]-N-[6-(piperidin-1-ylmethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]acetamide |
| SMILES | O=C(CC1C(=O)NCCN1S(=O)(=O)c1ccc(Cl)cc1)NC1CCC2CC(CN3CCCCC3)CCC2C1 |
| InChI | InChI=1S/C28H41ClN4O4S/c29-23-7-10-25(11-8-23)38(36,37)33-15-12-30-28(35)26(33)18-27(34)31-24-9-6-21-16-20(4-5-22(21)17-24)19-32-13-2-1-3-14-32/h7-8,10-11,20-22,24,26H,1-6,9,12-19H2,(H,30,35)(H,31,34) |
| InChIKey | PWZKLBMYNJEFML-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.18 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |