C28H34ClN3O5S3 — CID 158443168
2-[(2R)-1-(4-chlorophenyl)sulfonyl-3-oxopiperazin-2-yl]-N-[(1R)-6-(2-oxoethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide;dithiane (PubChem CID 158443168) has the molecular formula C28H34ClN3O5S3 and a molecular weight of 624.25 g/mol. Its IUPAC name is 2-[(2R)-1-(4-chlorophenyl)sulfonyl-3-oxopiperazin-2-yl]-N-[(1R)-6-(2-oxoethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide;dithiane.
| Compound Name | 2-[(2R)-1-(4-chlorophenyl)sulfonyl-3-oxopiperazin-2-yl]-N-[(1R)-6-(2-oxoethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide;dithiane |
|---|---|
| PubChem CID | 158443168 |
| Molecular Formula | C28H34ClN3O5S3 |
| Molecular Weight | 624.25 g/mol |
| Exact Mass | 623.13 |
| IUPAC Name | 2-[(2R)-1-(4-chlorophenyl)sulfonyl-3-oxopiperazin-2-yl]-N-[(1R)-6-(2-oxoethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide;dithiane |
| SMILES | C1CCSSC1.O=CCc1ccc2c(c1)CCC[C@H]2NC(=O)C[C@@H]1C(=O)NCCN1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H26ClN3O5S.C4H8S2/c25-18-5-7-19(8-6-18)34(32,33)28-12-11-26-24(31)22(28)15-23(30)27-21-3-1-2-17-14-16(10-13-29)4-9-20(17)21;1-2-4-6-5-3-1/h4-9,13-14,21-22H,1-3,10-12,15H2,(H,26,31)(H,27,30);1-4H2/t21-,22-;/m1./s1 |
| InChIKey | HDBJWHFELMUSDC-HLUKFBSCSA-N |
| XLogP | 4.32 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.25 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|