C27H34Cl2N4O4S — CID 69257437
2-[(2R)-1-(3,4-dichlorophenyl)sulfonyl-3-oxopiperazin-2-yl]-N-[(1R)-6-[(2-methylpropylamino)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide (PubChem CID 69257437) has the molecular formula C27H34Cl2N4O4S and a molecular weight of 581.57 g/mol. Its IUPAC name is 2-[(2R)-1-(3,4-dichlorophenyl)sulfonyl-3-oxopiperazin-2-yl]-N-[(1R)-6-[(2-methylpropylamino)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide.
| Compound Name | 2-[(2R)-1-(3,4-dichlorophenyl)sulfonyl-3-oxopiperazin-2-yl]-N-[(1R)-6-[(2-methylpropylamino)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
|---|---|
| PubChem CID | 69257437 |
| Molecular Formula | C27H34Cl2N4O4S |
| Molecular Weight | 581.57 g/mol |
| Exact Mass | 580.17 |
| IUPAC Name | 2-[(2R)-1-(3,4-dichlorophenyl)sulfonyl-3-oxopiperazin-2-yl]-N-[(1R)-6-[(2-methylpropylamino)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
| SMILES | CC(C)CNCc1ccc2c(c1)CCC[C@H]2NC(=O)C[C@@H]1C(=O)NCCN1S(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C27H34Cl2N4O4S/c1-17(2)15-30-16-18-6-8-21-19(12-18)4-3-5-24(21)32-26(34)14-25-27(35)31-10-11-33(25)38(36,37)20-7-9-22(28)23(29)13-20/h6-9,12-13,17,24-25,30H,3-5,10-11,14-16H2,1-2H3,(H,31,35)(H,32,34)/t24-,25-/m1/s1 |
| InChIKey | OVJWLZLJJZBYLX-JWQCQUIFSA-N |
| XLogP | 3.81 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.57 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |