C12H14BrClN2O3S — CID 106546001
4-(3-bromo-4-chlorophenyl)sulfonyl-3-ethylpiperazin-2-one (PubChem CID 106546001) has the molecular formula C12H14BrClN2O3S and a molecular weight of 381.68 g/mol. Its IUPAC name is 4-(3-bromo-4-chlorophenyl)sulfonyl-3-ethylpiperazin-2-one.
| Compound Name | 4-(3-bromo-4-chlorophenyl)sulfonyl-3-ethylpiperazin-2-one |
|---|---|
| PubChem CID | 106546001 |
| Molecular Formula | C12H14BrClN2O3S |
| Molecular Weight | 381.68 g/mol |
| Exact Mass | 379.96 |
| IUPAC Name | 4-(3-bromo-4-chlorophenyl)sulfonyl-3-ethylpiperazin-2-one |
| SMILES | CCC1C(=O)NCCN1S(=O)(=O)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C12H14BrClN2O3S/c1-2-11-12(17)15-5-6-16(11)20(18,19)8-3-4-10(14)9(13)7-8/h3-4,7,11H,2,5-6H2,1H3,(H,15,17) |
| InChIKey | JAPOSSVTYOJCJO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.68 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |