C11H15BrCl2N2O2S — CID 120716985
(2R)-1-(3-bromo-4-chlorophenyl)sulfonyl-2-methylpiperazine;hydrochloride (PubChem CID 120716985) has the molecular formula C11H15BrCl2N2O2S and a molecular weight of 390.13 g/mol. Its IUPAC name is (2R)-1-(3-bromo-4-chlorophenyl)sulfonyl-2-methylpiperazine;hydrochloride.
| Compound Name | (2R)-1-(3-bromo-4-chlorophenyl)sulfonyl-2-methylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120716985 |
| Molecular Formula | C11H15BrCl2N2O2S |
| Molecular Weight | 390.13 g/mol |
| Exact Mass | 387.94 |
| IUPAC Name | (2R)-1-(3-bromo-4-chlorophenyl)sulfonyl-2-methylpiperazine;hydrochloride |
| SMILES | C[C@@H]1CNCCN1S(=O)(=O)c1ccc(Cl)c(Br)c1.Cl |
| InChI | InChI=1S/C11H14BrClN2O2S.ClH/c1-8-7-14-4-5-15(8)18(16,17)9-2-3-11(13)10(12)6-9;/h2-3,6,8,14H,4-5,7H2,1H3;1H/t8-;/m1./s1 |
| InChIKey | IOOJKYQAWIVBAM-DDWIOCJRSA-N |
| XLogP | 2.51 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.13 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |