C13H21ClN2O2S — CID 120716906
(2R)-1-(3,4-dimethylphenyl)sulfonyl-2-methylpiperazine;hydrochloride (PubChem CID 120716906) has the molecular formula C13H21ClN2O2S and a molecular weight of 304.84 g/mol. Its IUPAC name is (2R)-1-(3,4-dimethylphenyl)sulfonyl-2-methylpiperazine;hydrochloride.
| Compound Name | (2R)-1-(3,4-dimethylphenyl)sulfonyl-2-methylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120716906 |
| Molecular Formula | C13H21ClN2O2S |
| Molecular Weight | 304.84 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | (2R)-1-(3,4-dimethylphenyl)sulfonyl-2-methylpiperazine;hydrochloride |
| SMILES | Cc1ccc(S(=O)(=O)N2CCNC[C@H]2C)cc1C.Cl |
| InChI | InChI=1S/C13H20N2O2S.ClH/c1-10-4-5-13(8-11(10)2)18(16,17)15-7-6-14-9-12(15)3;/h4-5,8,12,14H,6-7,9H2,1-3H3;1H/t12-;/m1./s1 |
| InChIKey | KFDHLMXLQQCDOD-UTONKHPSSA-N |
| XLogP | 1.71 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.84 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |