C11H15IN2O2S — CID 82755760
(2S)-1-(4-iodophenyl)sulfonyl-2-methylpiperazine (PubChem CID 82755760) has the molecular formula C11H15IN2O2S and a molecular weight of 366.22 g/mol. Its IUPAC name is (2S)-1-(4-iodophenyl)sulfonyl-2-methylpiperazine.
| Compound Name | (2S)-1-(4-iodophenyl)sulfonyl-2-methylpiperazine |
|---|---|
| PubChem CID | 82755760 |
| Molecular Formula | C11H15IN2O2S |
| Molecular Weight | 366.22 g/mol |
| Exact Mass | 365.99 |
| IUPAC Name | (2S)-1-(4-iodophenyl)sulfonyl-2-methylpiperazine |
| SMILES | C[C@H]1CNCCN1S(=O)(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C11H15IN2O2S/c1-9-8-13-6-7-14(9)17(15,16)11-4-2-10(12)3-5-11/h2-5,9,13H,6-8H2,1H3/t9-/m0/s1 |
| InChIKey | FONWNPKAUDEDFH-VIFPVBQESA-N |
| XLogP | 1.27 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.22 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|