C11H14F2N2O2S — CID 82756368
(2S)-1-(3,5-difluorophenyl)sulfonyl-2-methylpiperazine (PubChem CID 82756368) has the molecular formula C11H14F2N2O2S and a molecular weight of 276.31 g/mol. Its IUPAC name is (2S)-1-(3,5-difluorophenyl)sulfonyl-2-methylpiperazine.
| Compound Name | (2S)-1-(3,5-difluorophenyl)sulfonyl-2-methylpiperazine |
|---|---|
| PubChem CID | 82756368 |
| Molecular Formula | C11H14F2N2O2S |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | (2S)-1-(3,5-difluorophenyl)sulfonyl-2-methylpiperazine |
| SMILES | C[C@H]1CNCCN1S(=O)(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C11H14F2N2O2S/c1-8-7-14-2-3-15(8)18(16,17)11-5-9(12)4-10(13)6-11/h4-6,8,14H,2-3,7H2,1H3/t8-/m0/s1 |
| InChIKey | SUAZHUXVXAYNKO-QMMMGPOBSA-N |
| XLogP | 0.95 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |