C12H18ClFN2O4S2 — CID 119969694
1-(3-fluoro-4-methylsulfonylphenyl)sulfonyl-2-methylpiperazine;hydrochloride (PubChem CID 119969694) has the molecular formula C12H18ClFN2O4S2 and a molecular weight of 372.87 g/mol. Its IUPAC name is 1-(3-fluoro-4-methylsulfonylphenyl)sulfonyl-2-methylpiperazine;hydrochloride.
| Compound Name | 1-(3-fluoro-4-methylsulfonylphenyl)sulfonyl-2-methylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 119969694 |
| Molecular Formula | C12H18ClFN2O4S2 |
| Molecular Weight | 372.87 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 1-(3-fluoro-4-methylsulfonylphenyl)sulfonyl-2-methylpiperazine;hydrochloride |
| SMILES | CC1CNCCN1S(=O)(=O)c1ccc(S(C)(=O)=O)c(F)c1.Cl |
| InChI | InChI=1S/C12H17FN2O4S2.ClH/c1-9-8-14-5-6-15(9)21(18,19)10-3-4-12(11(13)7-10)20(2,16)17;/h3-4,7,9,14H,5-6,8H2,1-2H3;1H |
| InChIKey | BGWVIHQECUAIPC-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.87 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |