C12H15ClFN3O2S — CID 119969888
2-fluoro-5-(2-methylpiperazin-1-yl)sulfonylbenzonitrile;hydrochloride (PubChem CID 119969888) has the molecular formula C12H15ClFN3O2S and a molecular weight of 319.79 g/mol. Its IUPAC name is 2-fluoro-5-(2-methylpiperazin-1-yl)sulfonylbenzonitrile;hydrochloride.
| Compound Name | 2-fluoro-5-(2-methylpiperazin-1-yl)sulfonylbenzonitrile;hydrochloride |
|---|---|
| PubChem CID | 119969888 |
| Molecular Formula | C12H15ClFN3O2S |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 2-fluoro-5-(2-methylpiperazin-1-yl)sulfonylbenzonitrile;hydrochloride |
| SMILES | CC1CNCCN1S(=O)(=O)c1ccc(F)c(C#N)c1.Cl |
| InChI | InChI=1S/C12H14FN3O2S.ClH/c1-9-8-15-4-5-16(9)19(17,18)11-2-3-12(13)10(6-11)7-14;/h2-3,6,9,15H,4-5,8H2,1H3;1H |
| InChIKey | JNRQQCRYKQEEBM-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |