C12H15ClFN3O2S — CID 119963361
5-(1,4-diazepan-1-ylsulfonyl)-2-fluorobenzonitrile;hydrochloride (PubChem CID 119963361) has the molecular formula C12H15ClFN3O2S and a molecular weight of 319.79 g/mol. Its IUPAC name is 5-(1,4-diazepan-1-ylsulfonyl)-2-fluorobenzonitrile;hydrochloride.
| Compound Name | 5-(1,4-diazepan-1-ylsulfonyl)-2-fluorobenzonitrile;hydrochloride |
|---|---|
| PubChem CID | 119963361 |
| Molecular Formula | C12H15ClFN3O2S |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 5-(1,4-diazepan-1-ylsulfonyl)-2-fluorobenzonitrile;hydrochloride |
| SMILES | Cl.N#Cc1cc(S(=O)(=O)N2CCCNCC2)ccc1F |
| InChI | InChI=1S/C12H14FN3O2S.ClH/c13-12-3-2-11(8-10(12)9-14)19(17,18)16-6-1-4-15-5-7-16;/h2-3,8,15H,1,4-7H2;1H |
| InChIKey | AMTKKIWJWFEYEA-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |