C12H15F3N2O3S — CID 120999337
1-[4-(difluoromethoxy)-3-fluorophenyl]sulfonyl-1,4-diazepane (PubChem CID 120999337) has the molecular formula C12H15F3N2O3S and a molecular weight of 324.32 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)-3-fluorophenyl]sulfonyl-1,4-diazepane.
| Compound Name | 1-[4-(difluoromethoxy)-3-fluorophenyl]sulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 120999337 |
| Molecular Formula | C12H15F3N2O3S |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 1-[4-(difluoromethoxy)-3-fluorophenyl]sulfonyl-1,4-diazepane |
| SMILES | O=S(=O)(c1ccc(OC(F)F)c(F)c1)N1CCCNCC1 |
| InChI | InChI=1S/C12H15F3N2O3S/c13-10-8-9(2-3-11(10)20-12(14)15)21(18,19)17-6-1-4-16-5-7-17/h2-3,8,12,16H,1,4-7H2 |
| InChIKey | ZOATUZDLLDZICF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |