C16H16F3N3O3S — CID 120876710
1-[4-(difluoromethoxy)-3-fluorophenyl]sulfonyl-2-pyridin-3-ylpiperazine (PubChem CID 120876710) has the molecular formula C16H16F3N3O3S and a molecular weight of 387.38 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)-3-fluorophenyl]sulfonyl-2-pyridin-3-ylpiperazine.
| Compound Name | 1-[4-(difluoromethoxy)-3-fluorophenyl]sulfonyl-2-pyridin-3-ylpiperazine |
|---|---|
| PubChem CID | 120876710 |
| Molecular Formula | C16H16F3N3O3S |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 1-[4-(difluoromethoxy)-3-fluorophenyl]sulfonyl-2-pyridin-3-ylpiperazine |
| SMILES | O=S(=O)(c1ccc(OC(F)F)c(F)c1)N1CCNCC1c1cccnc1 |
| InChI | InChI=1S/C16H16F3N3O3S/c17-13-8-12(3-4-15(13)25-16(18)19)26(23,24)22-7-6-21-10-14(22)11-2-1-5-20-9-11/h1-5,8-9,14,16,21H,6-7,10H2 |
| InChIKey | DMEGXTIMWZFWQV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |