C15H16FN3O2S — CID 120763589
1-(3-fluorophenyl)sulfonyl-2-pyridin-3-ylpiperazine (PubChem CID 120763589) has the molecular formula C15H16FN3O2S and a molecular weight of 321.38 g/mol. Its IUPAC name is 1-(3-fluorophenyl)sulfonyl-2-pyridin-3-ylpiperazine.
| Compound Name | 1-(3-fluorophenyl)sulfonyl-2-pyridin-3-ylpiperazine |
|---|---|
| PubChem CID | 120763589 |
| Molecular Formula | C15H16FN3O2S |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 1-(3-fluorophenyl)sulfonyl-2-pyridin-3-ylpiperazine |
| SMILES | O=S(=O)(c1cccc(F)c1)N1CCNCC1c1cccnc1 |
| InChI | InChI=1S/C15H16FN3O2S/c16-13-4-1-5-14(9-13)22(20,21)19-8-7-18-11-15(19)12-3-2-6-17-10-12/h1-6,9-10,15,18H,7-8,11H2 |
| InChIKey | OOXHHUSMRLBFRG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |