C16H18ClN7O2S — CID 120763566
2-pyridin-3-yl-1-[3-(tetrazol-1-yl)phenyl]sulfonylpiperazine;hydrochloride (PubChem CID 120763566) has the molecular formula C16H18ClN7O2S and a molecular weight of 407.89 g/mol. Its IUPAC name is 2-pyridin-3-yl-1-[3-(tetrazol-1-yl)phenyl]sulfonylpiperazine;hydrochloride.
| Compound Name | 2-pyridin-3-yl-1-[3-(tetrazol-1-yl)phenyl]sulfonylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120763566 |
| Molecular Formula | C16H18ClN7O2S |
| Molecular Weight | 407.89 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 2-pyridin-3-yl-1-[3-(tetrazol-1-yl)phenyl]sulfonylpiperazine;hydrochloride |
| SMILES | Cl.O=S(=O)(c1cccc(-n2cnnn2)c1)N1CCNCC1c1cccnc1 |
| InChI | InChI=1S/C16H17N7O2S.ClH/c24-26(25,15-5-1-4-14(9-15)22-12-19-20-21-22)23-8-7-18-11-16(23)13-3-2-6-17-10-13;/h1-6,9-10,12,16,18H,7-8,11H2;1H |
| InChIKey | IODJXVLKPIDNIK-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 105.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.89 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |