C17H20ClN3O3S — CID 120763835
1-[4-(2-pyridin-3-ylpiperazin-1-yl)sulfonylphenyl]ethanone;hydrochloride (PubChem CID 120763835) has the molecular formula C17H20ClN3O3S and a molecular weight of 381.89 g/mol. Its IUPAC name is 1-[4-(2-pyridin-3-ylpiperazin-1-yl)sulfonylphenyl]ethanone;hydrochloride.
| Compound Name | 1-[4-(2-pyridin-3-ylpiperazin-1-yl)sulfonylphenyl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 120763835 |
| Molecular Formula | C17H20ClN3O3S |
| Molecular Weight | 381.89 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 1-[4-(2-pyridin-3-ylpiperazin-1-yl)sulfonylphenyl]ethanone;hydrochloride |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N2CCNCC2c2cccnc2)cc1.Cl |
| InChI | InChI=1S/C17H19N3O3S.ClH/c1-13(21)14-4-6-16(7-5-14)24(22,23)20-10-9-19-12-17(20)15-3-2-8-18-11-15;/h2-8,11,17,19H,9-10,12H2,1H3;1H |
| InChIKey | IOUWLJLRFNTPAF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.89 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |