C16H19ClN4O3S — CID 120763620
3-(2-pyridin-3-ylpiperazin-1-yl)sulfonylbenzamide;hydrochloride (PubChem CID 120763620) has the molecular formula C16H19ClN4O3S and a molecular weight of 382.87 g/mol. Its IUPAC name is 3-(2-pyridin-3-ylpiperazin-1-yl)sulfonylbenzamide;hydrochloride.
| Compound Name | 3-(2-pyridin-3-ylpiperazin-1-yl)sulfonylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 120763620 |
| Molecular Formula | C16H19ClN4O3S |
| Molecular Weight | 382.87 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 3-(2-pyridin-3-ylpiperazin-1-yl)sulfonylbenzamide;hydrochloride |
| SMILES | Cl.NC(=O)c1cccc(S(=O)(=O)N2CCNCC2c2cccnc2)c1 |
| InChI | InChI=1S/C16H18N4O3S.ClH/c17-16(21)12-3-1-5-14(9-12)24(22,23)20-8-7-19-11-15(20)13-4-2-6-18-10-13;/h1-6,9-10,15,19H,7-8,11H2,(H2,17,21);1H |
| InChIKey | QZNBDZGCNGTIGA-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.87 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |