C15H15ClF3N3O2S — CID 120763965
2-pyridin-3-yl-1-(3,4,5-trifluorophenyl)sulfonylpiperazine;hydrochloride (PubChem CID 120763965) has the molecular formula C15H15ClF3N3O2S and a molecular weight of 393.82 g/mol. Its IUPAC name is 2-pyridin-3-yl-1-(3,4,5-trifluorophenyl)sulfonylpiperazine;hydrochloride.
| Compound Name | 2-pyridin-3-yl-1-(3,4,5-trifluorophenyl)sulfonylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120763965 |
| Molecular Formula | C15H15ClF3N3O2S |
| Molecular Weight | 393.82 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | 2-pyridin-3-yl-1-(3,4,5-trifluorophenyl)sulfonylpiperazine;hydrochloride |
| SMILES | Cl.O=S(=O)(c1cc(F)c(F)c(F)c1)N1CCNCC1c1cccnc1 |
| InChI | InChI=1S/C15H14F3N3O2S.ClH/c16-12-6-11(7-13(17)15(12)18)24(22,23)21-5-4-20-9-14(21)10-2-1-3-19-8-10;/h1-3,6-8,14,20H,4-5,9H2;1H |
| InChIKey | SOODEFGZDZOYRN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.82 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|