C17H22ClN3O4S2 — CID 120763550
1-[4-(methylsulfonylmethyl)phenyl]sulfonyl-2-pyridin-3-ylpiperazine;hydrochloride (PubChem CID 120763550) has the molecular formula C17H22ClN3O4S2 and a molecular weight of 431.97 g/mol. Its IUPAC name is 1-[4-(methylsulfonylmethyl)phenyl]sulfonyl-2-pyridin-3-ylpiperazine;hydrochloride.
| Compound Name | 1-[4-(methylsulfonylmethyl)phenyl]sulfonyl-2-pyridin-3-ylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120763550 |
| Molecular Formula | C17H22ClN3O4S2 |
| Molecular Weight | 431.97 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | 1-[4-(methylsulfonylmethyl)phenyl]sulfonyl-2-pyridin-3-ylpiperazine;hydrochloride |
| SMILES | CS(=O)(=O)Cc1ccc(S(=O)(=O)N2CCNCC2c2cccnc2)cc1.Cl |
| InChI | InChI=1S/C17H21N3O4S2.ClH/c1-25(21,22)13-14-4-6-16(7-5-14)26(23,24)20-10-9-19-12-17(20)15-3-2-8-18-11-15;/h2-8,11,17,19H,9-10,12-13H2,1H3;1H |
| InChIKey | WBXGPQWAKBVPLO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.97 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |