C16H20ClN3O2S — CID 120763847
1-benzylsulfonyl-2-pyridin-3-ylpiperazine;hydrochloride (PubChem CID 120763847) has the molecular formula C16H20ClN3O2S and a molecular weight of 353.88 g/mol. Its IUPAC name is 1-benzylsulfonyl-2-pyridin-3-ylpiperazine;hydrochloride.
| Compound Name | 1-benzylsulfonyl-2-pyridin-3-ylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120763847 |
| Molecular Formula | C16H20ClN3O2S |
| Molecular Weight | 353.88 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 1-benzylsulfonyl-2-pyridin-3-ylpiperazine;hydrochloride |
| SMILES | Cl.O=S(=O)(Cc1ccccc1)N1CCNCC1c1cccnc1 |
| InChI | InChI=1S/C16H19N3O2S.ClH/c20-22(21,13-14-5-2-1-3-6-14)19-10-9-18-12-16(19)15-7-4-8-17-11-15;/h1-8,11,16,18H,9-10,12-13H2;1H |
| InChIKey | UWKFFMKOEQRLRQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.88 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |