C14H22N4O2S — CID 120763826
1-piperidin-1-ylsulfonyl-2-pyridin-3-ylpiperazine (PubChem CID 120763826) has the molecular formula C14H22N4O2S and a molecular weight of 310.42 g/mol. Its IUPAC name is 1-piperidin-1-ylsulfonyl-2-pyridin-3-ylpiperazine.
| Compound Name | 1-piperidin-1-ylsulfonyl-2-pyridin-3-ylpiperazine |
|---|---|
| PubChem CID | 120763826 |
| Molecular Formula | C14H22N4O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 1-piperidin-1-ylsulfonyl-2-pyridin-3-ylpiperazine |
| SMILES | O=S(=O)(N1CCCCC1)N1CCNCC1c1cccnc1 |
| InChI | InChI=1S/C14H22N4O2S/c19-21(20,17-8-2-1-3-9-17)18-10-7-16-12-14(18)13-5-4-6-15-11-13/h4-6,11,14,16H,1-3,7-10,12H2 |
| InChIKey | RBBJAMLDTDHPOY-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |