C15H24N4O3S — CID 120763667
2,5-dimethyl-4-(2-pyridin-3-ylpiperazin-1-yl)sulfonylmorpholine (PubChem CID 120763667) has the molecular formula C15H24N4O3S and a molecular weight of 340.45 g/mol. Its IUPAC name is 2,5-dimethyl-4-(2-pyridin-3-ylpiperazin-1-yl)sulfonylmorpholine.
| Compound Name | 2,5-dimethyl-4-(2-pyridin-3-ylpiperazin-1-yl)sulfonylmorpholine |
|---|---|
| PubChem CID | 120763667 |
| Molecular Formula | C15H24N4O3S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 2,5-dimethyl-4-(2-pyridin-3-ylpiperazin-1-yl)sulfonylmorpholine |
| SMILES | CC1CN(S(=O)(=O)N2CCNCC2c2cccnc2)C(C)CO1 |
| InChI | InChI=1S/C15H24N4O3S/c1-12-11-22-13(2)10-19(12)23(20,21)18-7-6-17-9-15(18)14-4-3-5-16-8-14/h3-5,8,12-13,15,17H,6-7,9-11H2,1-2H3 |
| InChIKey | NPROQPZXOVJJNL-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |