C16H19BrClN3O2S — CID 120764349
1-(2-bromo-3-methylphenyl)sulfonyl-2-pyridin-3-ylpiperazine;hydrochloride (PubChem CID 120764349) has the molecular formula C16H19BrClN3O2S and a molecular weight of 432.77 g/mol. Its IUPAC name is 1-(2-bromo-3-methylphenyl)sulfonyl-2-pyridin-3-ylpiperazine;hydrochloride.
| Compound Name | 1-(2-bromo-3-methylphenyl)sulfonyl-2-pyridin-3-ylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120764349 |
| Molecular Formula | C16H19BrClN3O2S |
| Molecular Weight | 432.77 g/mol |
| Exact Mass | 431.01 |
| IUPAC Name | 1-(2-bromo-3-methylphenyl)sulfonyl-2-pyridin-3-ylpiperazine;hydrochloride |
| SMILES | Cc1cccc(S(=O)(=O)N2CCNCC2c2cccnc2)c1Br.Cl |
| InChI | InChI=1S/C16H18BrN3O2S.ClH/c1-12-4-2-6-15(16(12)17)23(21,22)20-9-8-19-11-14(20)13-5-3-7-18-10-13;/h2-7,10,14,19H,8-9,11H2,1H3;1H |
| InChIKey | AQKDRUNPIZOIFD-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.77 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |