C15H15Cl3FN3O2S — CID 120763688
1-(2,4-dichloro-3-fluorophenyl)sulfonyl-2-pyridin-3-ylpiperazine;hydrochloride (PubChem CID 120763688) has the molecular formula C15H15Cl3FN3O2S and a molecular weight of 426.73 g/mol. Its IUPAC name is 1-(2,4-dichloro-3-fluorophenyl)sulfonyl-2-pyridin-3-ylpiperazine;hydrochloride.
| Compound Name | 1-(2,4-dichloro-3-fluorophenyl)sulfonyl-2-pyridin-3-ylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120763688 |
| Molecular Formula | C15H15Cl3FN3O2S |
| Molecular Weight | 426.73 g/mol |
| Exact Mass | 424.99 |
| IUPAC Name | 1-(2,4-dichloro-3-fluorophenyl)sulfonyl-2-pyridin-3-ylpiperazine;hydrochloride |
| SMILES | Cl.O=S(=O)(c1ccc(Cl)c(F)c1Cl)N1CCNCC1c1cccnc1 |
| InChI | InChI=1S/C15H14Cl2FN3O2S.ClH/c16-11-3-4-13(14(17)15(11)18)24(22,23)21-7-6-20-9-12(21)10-2-1-5-19-8-10;/h1-5,8,12,20H,6-7,9H2;1H |
| InChIKey | XKJWUPZCCDIVCE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.73 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|