C14H16ClN5O2S — CID 120763663
5-chloro-3-(2-pyridin-3-ylpiperazin-1-yl)sulfonylpyridin-2-amine (PubChem CID 120763663) has the molecular formula C14H16ClN5O2S and a molecular weight of 353.84 g/mol. Its IUPAC name is 5-chloro-3-(2-pyridin-3-ylpiperazin-1-yl)sulfonylpyridin-2-amine.
| Compound Name | 5-chloro-3-(2-pyridin-3-ylpiperazin-1-yl)sulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 120763663 |
| Molecular Formula | C14H16ClN5O2S |
| Molecular Weight | 353.84 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 5-chloro-3-(2-pyridin-3-ylpiperazin-1-yl)sulfonylpyridin-2-amine |
| SMILES | Nc1ncc(Cl)cc1S(=O)(=O)N1CCNCC1c1cccnc1 |
| InChI | InChI=1S/C14H16ClN5O2S/c15-11-6-13(14(16)19-8-11)23(21,22)20-5-4-18-9-12(20)10-2-1-3-17-7-10/h1-3,6-8,12,18H,4-5,9H2,(H2,16,19) |
| InChIKey | OMDAJHQQSYQENB-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.84 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |