C15H17Cl3N4O2S — CID 120776773
5-chloro-3-[2-(3-chlorophenyl)piperazin-1-yl]sulfonylpyridin-2-amine;hydrochloride (PubChem CID 120776773) has the molecular formula C15H17Cl3N4O2S and a molecular weight of 423.75 g/mol. Its IUPAC name is 5-chloro-3-[2-(3-chlorophenyl)piperazin-1-yl]sulfonylpyridin-2-amine;hydrochloride.
| Compound Name | 5-chloro-3-[2-(3-chlorophenyl)piperazin-1-yl]sulfonylpyridin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 120776773 |
| Molecular Formula | C15H17Cl3N4O2S |
| Molecular Weight | 423.75 g/mol |
| Exact Mass | 422.01 |
| IUPAC Name | 5-chloro-3-[2-(3-chlorophenyl)piperazin-1-yl]sulfonylpyridin-2-amine;hydrochloride |
| SMILES | Cl.Nc1ncc(Cl)cc1S(=O)(=O)N1CCNCC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H16Cl2N4O2S.ClH/c16-11-3-1-2-10(6-11)13-9-19-4-5-21(13)24(22,23)14-7-12(17)8-20-15(14)18;/h1-3,6-8,13,19H,4-5,9H2,(H2,18,20);1H |
| InChIKey | ZCXKDZQLJGOBER-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.75 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |