C16H16Cl2FN3O4S — CID 120764720
1-(5-chloro-2-nitrophenyl)sulfonyl-2-(3-fluorophenyl)piperazine;hydrochloride (PubChem CID 120764720) has the molecular formula C16H16Cl2FN3O4S and a molecular weight of 436.29 g/mol. Its IUPAC name is 1-(5-chloro-2-nitrophenyl)sulfonyl-2-(3-fluorophenyl)piperazine;hydrochloride.
| Compound Name | 1-(5-chloro-2-nitrophenyl)sulfonyl-2-(3-fluorophenyl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 120764720 |
| Molecular Formula | C16H16Cl2FN3O4S |
| Molecular Weight | 436.29 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | 1-(5-chloro-2-nitrophenyl)sulfonyl-2-(3-fluorophenyl)piperazine;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc(Cl)cc1S(=O)(=O)N1CCNCC1c1cccc(F)c1 |
| InChI | InChI=1S/C16H15ClFN3O4S.ClH/c17-12-4-5-14(21(22)23)16(9-12)26(24,25)20-7-6-19-10-15(20)11-2-1-3-13(18)8-11;/h1-5,8-9,15,19H,6-7,10H2;1H |
| InChIKey | ORIVQYLYBIIBTJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|