C17H19ClFN3O4S — CID 120764998
2-(3-fluorophenyl)-1-(2-methyl-4-nitrophenyl)sulfonylpiperazine;hydrochloride (PubChem CID 120764998) has the molecular formula C17H19ClFN3O4S and a molecular weight of 415.87 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-1-(2-methyl-4-nitrophenyl)sulfonylpiperazine;hydrochloride.
| Compound Name | 2-(3-fluorophenyl)-1-(2-methyl-4-nitrophenyl)sulfonylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120764998 |
| Molecular Formula | C17H19ClFN3O4S |
| Molecular Weight | 415.87 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | 2-(3-fluorophenyl)-1-(2-methyl-4-nitrophenyl)sulfonylpiperazine;hydrochloride |
| SMILES | Cc1cc([N+](=O)[O-])ccc1S(=O)(=O)N1CCNCC1c1cccc(F)c1.Cl |
| InChI | InChI=1S/C17H18FN3O4S.ClH/c1-12-9-15(21(22)23)5-6-17(12)26(24,25)20-8-7-19-11-16(20)13-3-2-4-14(18)10-13;/h2-6,9-10,16,19H,7-8,11H2,1H3;1H |
| InChIKey | AMHJDEBBWNXFFM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.87 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|