C19H22ClFN2O4S — CID 120764505
methyl 3-[2-(3-fluorophenyl)piperazin-1-yl]sulfonyl-2-methylbenzoate;hydrochloride (PubChem CID 120764505) has the molecular formula C19H22ClFN2O4S and a molecular weight of 428.91 g/mol. Its IUPAC name is methyl 3-[2-(3-fluorophenyl)piperazin-1-yl]sulfonyl-2-methylbenzoate;hydrochloride.
| Compound Name | methyl 3-[2-(3-fluorophenyl)piperazin-1-yl]sulfonyl-2-methylbenzoate;hydrochloride |
|---|---|
| PubChem CID | 120764505 |
| Molecular Formula | C19H22ClFN2O4S |
| Molecular Weight | 428.91 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | methyl 3-[2-(3-fluorophenyl)piperazin-1-yl]sulfonyl-2-methylbenzoate;hydrochloride |
| SMILES | COC(=O)c1cccc(S(=O)(=O)N2CCNCC2c2cccc(F)c2)c1C.Cl |
| InChI | InChI=1S/C19H21FN2O4S.ClH/c1-13-16(19(23)26-2)7-4-8-18(13)27(24,25)22-10-9-21-12-17(22)14-5-3-6-15(20)11-14;/h3-8,11,17,21H,9-10,12H2,1-2H3;1H |
| InChIKey | LJJVQGYJEKKOJT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.91 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |