C17H19FN2O4S2 — CID 120876756
methyl 3-[2-(3-fluorophenyl)piperazin-1-yl]sulfonyl-4-methylthiophene-2-carboxylate (PubChem CID 120876756) has the molecular formula C17H19FN2O4S2 and a molecular weight of 398.48 g/mol. Its IUPAC name is methyl 3-[2-(3-fluorophenyl)piperazin-1-yl]sulfonyl-4-methylthiophene-2-carboxylate.
| Compound Name | methyl 3-[2-(3-fluorophenyl)piperazin-1-yl]sulfonyl-4-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 120876756 |
| Molecular Formula | C17H19FN2O4S2 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | methyl 3-[2-(3-fluorophenyl)piperazin-1-yl]sulfonyl-4-methylthiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1S(=O)(=O)N1CCNCC1c1cccc(F)c1 |
| InChI | InChI=1S/C17H19FN2O4S2/c1-11-10-25-15(17(21)24-2)16(11)26(22,23)20-7-6-19-9-14(20)12-4-3-5-13(18)8-12/h3-5,8,10,14,19H,6-7,9H2,1-2H3 |
| InChIKey | JTFAIBKLQGGBHZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |