C15H19FN4O2S — CID 120764645
1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-2-(3-fluorophenyl)piperazine (PubChem CID 120764645) has the molecular formula C15H19FN4O2S and a molecular weight of 338.41 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-2-(3-fluorophenyl)piperazine.
| Compound Name | 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-2-(3-fluorophenyl)piperazine |
|---|---|
| PubChem CID | 120764645 |
| Molecular Formula | C15H19FN4O2S |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-2-(3-fluorophenyl)piperazine |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)N1CCNCC1c1cccc(F)c1 |
| InChI | InChI=1S/C15H19FN4O2S/c1-10-15(11(2)19-18-10)23(21,22)20-7-6-17-9-14(20)12-4-3-5-13(16)8-12/h3-5,8,14,17H,6-7,9H2,1-2H3,(H,18,19) |
| InChIKey | LPJMIXBUPNSAOM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |