C13H17FN2O2S — CID 120764492
1-cyclopropylsulfonyl-2-(3-fluorophenyl)piperazine (PubChem CID 120764492) has the molecular formula C13H17FN2O2S and a molecular weight of 284.36 g/mol. Its IUPAC name is 1-cyclopropylsulfonyl-2-(3-fluorophenyl)piperazine.
| Compound Name | 1-cyclopropylsulfonyl-2-(3-fluorophenyl)piperazine |
|---|---|
| PubChem CID | 120764492 |
| Molecular Formula | C13H17FN2O2S |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 1-cyclopropylsulfonyl-2-(3-fluorophenyl)piperazine |
| SMILES | O=S(=O)(C1CC1)N1CCNCC1c1cccc(F)c1 |
| InChI | InChI=1S/C13H17FN2O2S/c14-11-3-1-2-10(8-11)13-9-15-6-7-16(13)19(17,18)12-4-5-12/h1-3,8,12-13,15H,4-7,9H2 |
| InChIKey | HWGZSVSVJHXERQ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |