C15H23ClN2O2S — CID 120765370
1-cyclopropylsulfonyl-2-(4-ethylphenyl)piperazine;hydrochloride (PubChem CID 120765370) has the molecular formula C15H23ClN2O2S and a molecular weight of 330.88 g/mol. Its IUPAC name is 1-cyclopropylsulfonyl-2-(4-ethylphenyl)piperazine;hydrochloride.
| Compound Name | 1-cyclopropylsulfonyl-2-(4-ethylphenyl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 120765370 |
| Molecular Formula | C15H23ClN2O2S |
| Molecular Weight | 330.88 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 1-cyclopropylsulfonyl-2-(4-ethylphenyl)piperazine;hydrochloride |
| SMILES | CCc1ccc(C2CNCCN2S(=O)(=O)C2CC2)cc1.Cl |
| InChI | InChI=1S/C15H22N2O2S.ClH/c1-2-12-3-5-13(6-4-12)15-11-16-9-10-17(15)20(18,19)14-7-8-14;/h3-6,14-16H,2,7-11H2,1H3;1H |
| InChIKey | JYBKHYVPEZBSKZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.88 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |