C19H24ClN3O4S — CID 120765525
methyl 5-[2-(4-ethylphenyl)piperazin-1-yl]sulfonylpyridine-2-carboxylate;hydrochloride (PubChem CID 120765525) has the molecular formula C19H24ClN3O4S and a molecular weight of 425.94 g/mol. Its IUPAC name is methyl 5-[2-(4-ethylphenyl)piperazin-1-yl]sulfonylpyridine-2-carboxylate;hydrochloride.
| Compound Name | methyl 5-[2-(4-ethylphenyl)piperazin-1-yl]sulfonylpyridine-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 120765525 |
| Molecular Formula | C19H24ClN3O4S |
| Molecular Weight | 425.94 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | methyl 5-[2-(4-ethylphenyl)piperazin-1-yl]sulfonylpyridine-2-carboxylate;hydrochloride |
| SMILES | CCc1ccc(C2CNCCN2S(=O)(=O)c2ccc(C(=O)OC)nc2)cc1.Cl |
| InChI | InChI=1S/C19H23N3O4S.ClH/c1-3-14-4-6-15(7-5-14)18-13-20-10-11-22(18)27(24,25)16-8-9-17(21-12-16)19(23)26-2;/h4-9,12,18,20H,3,10-11,13H2,1-2H3;1H |
| InChIKey | XSLLLLVISGFZBO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.94 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |