C18H23ClN2O5S — CID 120765362
methyl 5-[2-(4-ethylphenyl)piperazin-1-yl]sulfonylfuran-2-carboxylate;hydrochloride (PubChem CID 120765362) has the molecular formula C18H23ClN2O5S and a molecular weight of 414.91 g/mol. Its IUPAC name is methyl 5-[2-(4-ethylphenyl)piperazin-1-yl]sulfonylfuran-2-carboxylate;hydrochloride.
| Compound Name | methyl 5-[2-(4-ethylphenyl)piperazin-1-yl]sulfonylfuran-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 120765362 |
| Molecular Formula | C18H23ClN2O5S |
| Molecular Weight | 414.91 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | methyl 5-[2-(4-ethylphenyl)piperazin-1-yl]sulfonylfuran-2-carboxylate;hydrochloride |
| SMILES | CCc1ccc(C2CNCCN2S(=O)(=O)c2ccc(C(=O)OC)o2)cc1.Cl |
| InChI | InChI=1S/C18H22N2O5S.ClH/c1-3-13-4-6-14(7-5-13)15-12-19-10-11-20(15)26(22,23)17-9-8-16(25-17)18(21)24-2;/h4-9,15,19H,3,10-12H2,1-2H3;1H |
| InChIKey | BQHRQTUPMPNZPZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.91 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |