C17H19ClN2O5S — CID 120776778
methyl 4-[2-(3-chlorophenyl)piperazin-1-yl]sulfonyl-5-methylfuran-2-carboxylate (PubChem CID 120776778) has the molecular formula C17H19ClN2O5S and a molecular weight of 398.87 g/mol. Its IUPAC name is methyl 4-[2-(3-chlorophenyl)piperazin-1-yl]sulfonyl-5-methylfuran-2-carboxylate.
| Compound Name | methyl 4-[2-(3-chlorophenyl)piperazin-1-yl]sulfonyl-5-methylfuran-2-carboxylate |
|---|---|
| PubChem CID | 120776778 |
| Molecular Formula | C17H19ClN2O5S |
| Molecular Weight | 398.87 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | methyl 4-[2-(3-chlorophenyl)piperazin-1-yl]sulfonyl-5-methylfuran-2-carboxylate |
| SMILES | COC(=O)c1cc(S(=O)(=O)N2CCNCC2c2cccc(Cl)c2)c(C)o1 |
| InChI | InChI=1S/C17H19ClN2O5S/c1-11-16(9-15(25-11)17(21)24-2)26(22,23)20-7-6-19-10-14(20)12-4-3-5-13(18)8-12/h3-5,8-9,14,19H,6-7,10H2,1-2H3 |
| InChIKey | OJGVBVAEMDFLAI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.87 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |