C18H21ClN2O4S — CID 120776752
2-(3-chlorophenyl)-1-(2,6-dimethoxyphenyl)sulfonylpiperazine (PubChem CID 120776752) has the molecular formula C18H21ClN2O4S and a molecular weight of 396.90 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1-(2,6-dimethoxyphenyl)sulfonylpiperazine.
| Compound Name | 2-(3-chlorophenyl)-1-(2,6-dimethoxyphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 120776752 |
| Molecular Formula | C18H21ClN2O4S |
| Molecular Weight | 396.90 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 2-(3-chlorophenyl)-1-(2,6-dimethoxyphenyl)sulfonylpiperazine |
| SMILES | COc1cccc(OC)c1S(=O)(=O)N1CCNCC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H21ClN2O4S/c1-24-16-7-4-8-17(25-2)18(16)26(22,23)21-10-9-20-12-15(21)13-5-3-6-14(19)11-13/h3-8,11,15,20H,9-10,12H2,1-2H3 |
| InChIKey | YDXXIBNLRCPFQO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.90 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |