C16H16Cl2F2N2O2S — CID 120777039
2-(3-chlorophenyl)-1-(2,3-difluorophenyl)sulfonylpiperazine;hydrochloride (PubChem CID 120777039) has the molecular formula C16H16Cl2F2N2O2S and a molecular weight of 409.29 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1-(2,3-difluorophenyl)sulfonylpiperazine;hydrochloride.
| Compound Name | 2-(3-chlorophenyl)-1-(2,3-difluorophenyl)sulfonylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120777039 |
| Molecular Formula | C16H16Cl2F2N2O2S |
| Molecular Weight | 409.29 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | 2-(3-chlorophenyl)-1-(2,3-difluorophenyl)sulfonylpiperazine;hydrochloride |
| SMILES | Cl.O=S(=O)(c1cccc(F)c1F)N1CCNCC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H15ClF2N2O2S.ClH/c17-12-4-1-3-11(9-12)14-10-20-7-8-21(14)24(22,23)15-6-2-5-13(18)16(15)19;/h1-6,9,14,20H,7-8,10H2;1H |
| InChIKey | OYCJXSBJZULILD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.29 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |