C18H19Cl2N3O2S — CID 120776845
4-[2-(3-chlorophenyl)piperazin-1-yl]sulfonyl-3-methylbenzonitrile;hydrochloride (PubChem CID 120776845) has the molecular formula C18H19Cl2N3O2S and a molecular weight of 412.34 g/mol. Its IUPAC name is 4-[2-(3-chlorophenyl)piperazin-1-yl]sulfonyl-3-methylbenzonitrile;hydrochloride.
| Compound Name | 4-[2-(3-chlorophenyl)piperazin-1-yl]sulfonyl-3-methylbenzonitrile;hydrochloride |
|---|---|
| PubChem CID | 120776845 |
| Molecular Formula | C18H19Cl2N3O2S |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 4-[2-(3-chlorophenyl)piperazin-1-yl]sulfonyl-3-methylbenzonitrile;hydrochloride |
| SMILES | Cc1cc(C#N)ccc1S(=O)(=O)N1CCNCC1c1cccc(Cl)c1.Cl |
| InChI | InChI=1S/C18H18ClN3O2S.ClH/c1-13-9-14(11-20)5-6-18(13)25(23,24)22-8-7-21-12-17(22)15-3-2-4-16(19)10-15;/h2-6,9-10,17,21H,7-8,12H2,1H3;1H |
| InChIKey | HHEDGBYJFJZENK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |