C13H18ClN3O2S — CID 119969685
3-methyl-4-(2-methylpiperazin-1-yl)sulfonylbenzonitrile;hydrochloride (PubChem CID 119969685) has the molecular formula C13H18ClN3O2S and a molecular weight of 315.83 g/mol. Its IUPAC name is 3-methyl-4-(2-methylpiperazin-1-yl)sulfonylbenzonitrile;hydrochloride.
| Compound Name | 3-methyl-4-(2-methylpiperazin-1-yl)sulfonylbenzonitrile;hydrochloride |
|---|---|
| PubChem CID | 119969685 |
| Molecular Formula | C13H18ClN3O2S |
| Molecular Weight | 315.83 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 3-methyl-4-(2-methylpiperazin-1-yl)sulfonylbenzonitrile;hydrochloride |
| SMILES | Cc1cc(C#N)ccc1S(=O)(=O)N1CCNCC1C.Cl |
| InChI | InChI=1S/C13H17N3O2S.ClH/c1-10-7-12(8-14)3-4-13(10)19(17,18)16-6-5-15-9-11(16)2;/h3-4,7,11,15H,5-6,9H2,1-2H3;1H |
| InChIKey | XCRWYHQYKRKHQA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.83 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |