C12H18Cl2N2O2S — CID 120717060
(2S)-1-(2-chloro-4-methylphenyl)sulfonyl-2-methylpiperazine;hydrochloride (PubChem CID 120717060) has the molecular formula C12H18Cl2N2O2S and a molecular weight of 325.26 g/mol. Its IUPAC name is (2S)-1-(2-chloro-4-methylphenyl)sulfonyl-2-methylpiperazine;hydrochloride.
| Compound Name | (2S)-1-(2-chloro-4-methylphenyl)sulfonyl-2-methylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120717060 |
| Molecular Formula | C12H18Cl2N2O2S |
| Molecular Weight | 325.26 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | (2S)-1-(2-chloro-4-methylphenyl)sulfonyl-2-methylpiperazine;hydrochloride |
| SMILES | Cc1ccc(S(=O)(=O)N2CCNC[C@@H]2C)c(Cl)c1.Cl |
| InChI | InChI=1S/C12H17ClN2O2S.ClH/c1-9-3-4-12(11(13)7-9)18(16,17)15-6-5-14-8-10(15)2;/h3-4,7,10,14H,5-6,8H2,1-2H3;1H/t10-;/m0./s1 |
| InChIKey | FXJUYYDODJNYIC-PPHPATTJSA-N |
| XLogP | 2.05 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |