C11H14Cl4N2O2S — CID 120717146
(2S)-2-methyl-1-(2,4,6-trichlorophenyl)sulfonylpiperazine;hydrochloride (PubChem CID 120717146) has the molecular formula C11H14Cl4N2O2S and a molecular weight of 380.12 g/mol. Its IUPAC name is (2S)-2-methyl-1-(2,4,6-trichlorophenyl)sulfonylpiperazine;hydrochloride.
| Compound Name | (2S)-2-methyl-1-(2,4,6-trichlorophenyl)sulfonylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120717146 |
| Molecular Formula | C11H14Cl4N2O2S |
| Molecular Weight | 380.12 g/mol |
| Exact Mass | 377.95 |
| IUPAC Name | (2S)-2-methyl-1-(2,4,6-trichlorophenyl)sulfonylpiperazine;hydrochloride |
| SMILES | C[C@H]1CNCCN1S(=O)(=O)c1c(Cl)cc(Cl)cc1Cl.Cl |
| InChI | InChI=1S/C11H13Cl3N2O2S.ClH/c1-7-6-15-2-3-16(7)19(17,18)11-9(13)4-8(12)5-10(11)14;/h4-5,7,15H,2-3,6H2,1H3;1H/t7-;/m0./s1 |
| InChIKey | RFQIMXATOSTSQC-FJXQXJEOSA-N |
| XLogP | 3.05 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.12 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |